About [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine
[2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine (PubChem CID 143537883) has the molecular formula C15H18IN5
and a molecular weight of 395.25 g/mol. Its IUPAC name is [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine.
Molecular Properties
| Compound Name | [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine |
| PubChem CID | 143537883 |
| Molecular Formula | C15H18IN5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine |
| SMILES | NC(N)c1ccc2cc(-c3ccc(I(N)N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C15H18IN5/c17-15(18)11-2-1-10-7-13(21-14(10)8-11)9-3-5-12(6-4-9)16(19)20/h1-8,15,21H,17-20H2 |
| InChIKey | SFCLOZNZOMMPNN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine?
The IUPAC name of [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine (CID 143537883) is [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine.
What is the SMILES notation for [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine?
The canonical SMILES for [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine is NC(N)c1ccc2cc(-c3ccc(I(N)N)cc3)[nH]c2c1.
What is the InChIKey of [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine?
The InChIKey is SFCLOZNZOMMPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18IN5/c17-15(18)11-2-1-10-7-13(21-14(10)8-11)9-3-5-12(6-4-9)16(19)20/h1-8,15,21H,17-20H2.
What are the key properties of [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine?
[2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine has a molecular weight of 395.25 g/mol, XLogP of 2.17, 3 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(diamino-λ3-iodanyl)phenyl]-1H-indol-6-yl]methanediamine is sourced from PubChem (CID 143537883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).