C8H10N4O — CID 116939209
5-(diaminomethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 116939209) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-(diaminomethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(diaminomethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 116939209 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 5-(diaminomethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | NC(N)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H10N4O/c9-7(10)4-1-2-5-6(3-4)12-8(13)11-5/h1-3,7H,9-10H2,(H2,11,12,13) |
| InChIKey | SITXCBWNVZDNKH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|