C12H17N3O — CID 43186846
5-(1-amino-3-methylbutyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 43186846) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-(1-amino-3-methylbutyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(1-amino-3-methylbutyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 43186846 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-(1-amino-3-methylbutyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC(C)CC(N)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3O/c1-7(2)5-9(13)8-3-4-10-11(6-8)15-12(16)14-10/h3-4,6-7,9H,5,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | FJORUOPYBUNIAA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |