C12H18N4O — CID 116934066
5-(1,4-diamino-2-methylbutyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 116934066) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-(1,4-diamino-2-methylbutyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(1,4-diamino-2-methylbutyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 116934066 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-(1,4-diamino-2-methylbutyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC(CCN)C(N)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H18N4O/c1-7(4-5-13)11(14)8-2-3-9-10(6-8)16-12(17)15-9/h2-3,6-7,11H,4-5,13-14H2,1H3,(H2,15,16,17) |
| InChIKey | VJXYLCNLZNFZRD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |