C21H17N5O — CID 121165402
3-phenyl-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 121165402) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-phenyl-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121165402 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-phenyl-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccnc(-c2ccncc2)c1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H17N5O/c27-21(20-13-19(25-26-20)16-4-2-1-3-5-16)24-14-15-6-11-23-18(12-15)17-7-9-22-10-8-17/h1-13H,14H2,(H,24,27)(H,25,26) |
| InChIKey | IFVPYHTVVMEIGH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |