C22H19N5O2 — CID 121165473
3-(2-methoxyphenyl)-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 121165473) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-methoxyphenyl)-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121165473 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-[(2-pyridin-4-yl-4-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)NCc2ccnc(-c3ccncc3)c2)[nH]n1 |
| InChI | InChI=1S/C22H19N5O2/c1-29-21-5-3-2-4-17(21)19-13-20(27-26-19)22(28)25-14-15-6-11-24-18(12-15)16-7-9-23-10-8-16/h2-13H,14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | BTDHTLYSXPIERS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |