C21H19FN4O3S — CID 73052015
N-[(4-carbamimidoylphenyl)methyl]-4-fluoro-2-(4-sulfamoylphenyl)benzamide (PubChem CID 73052015) has the molecular formula C21H19FN4O3S and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-4-fluoro-2-(4-sulfamoylphenyl)benzamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-4-fluoro-2-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 73052015 |
| Molecular Formula | C21H19FN4O3S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-4-fluoro-2-(4-sulfamoylphenyl)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccc(F)cc2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H19FN4O3S/c22-16-7-10-18(19(11-16)14-5-8-17(9-6-14)30(25,28)29)21(27)26-12-13-1-3-15(4-2-13)20(23)24/h1-11H,12H2,(H3,23,24)(H,26,27)(H2,25,28,29) |
| InChIKey | WUHHRIUUHNIYNA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|