C26H31N3O4 — CID 172918172
[(Z)-[amino-[4-[(4S)-3-oxo-4-[[(1R,3R)-3-phenylcyclopentanecarbonyl]amino]pentyl]phenyl]methylidene]amino] acetate (PubChem CID 172918172) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is [(Z)-[amino-[4-[(4S)-3-oxo-4-[[(1R,3R)-3-phenylcyclopentanecarbonyl]amino]pentyl]phenyl]methylidene]amino] acetate.
| Compound Name | [(Z)-[amino-[4-[(4S)-3-oxo-4-[[(1R,3R)-3-phenylcyclopentanecarbonyl]amino]pentyl]phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 172918172 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | [(Z)-[amino-[4-[(4S)-3-oxo-4-[[(1R,3R)-3-phenylcyclopentanecarbonyl]amino]pentyl]phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\N)c1ccc(CCC(=O)[C@H](C)NC(=O)[C@@H]2CC[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-17(28-26(32)23-14-13-22(16-23)20-6-4-3-5-7-20)24(31)15-10-19-8-11-21(12-9-19)25(27)29-33-18(2)30/h3-9,11-12,17,22-23H,10,13-16H2,1-2H3,(H2,27,29)(H,28,32)/t17-,22+,23+/m0/s1 |
| InChIKey | IJJAQHBTDZZQTE-JJEOQYAHSA-N |
| XLogP | 3.46 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|