C24H31N — CID 163272023
[4-[2-[3-[2-(4-methylphenyl)ethyl]cyclohexyl]ethyl]phenyl]methanimine (PubChem CID 163272023) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is [4-[2-[3-[2-(4-methylphenyl)ethyl]cyclohexyl]ethyl]phenyl]methanimine.
| Compound Name | [4-[2-[3-[2-(4-methylphenyl)ethyl]cyclohexyl]ethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 163272023 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | [4-[2-[3-[2-(4-methylphenyl)ethyl]cyclohexyl]ethyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(CCC2CCCC(CCc3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C24H31N/c1-19-5-7-20(8-6-19)9-13-22-3-2-4-23(17-22)14-10-21-11-15-24(18-25)16-12-21/h5-8,11-12,15-16,18,22-23,25H,2-4,9-10,13-14,17H2,1H3/b25-18+ |
| InChIKey | XDQIYPJRIVGOJX-XIEYBQDHSA-N |
| XLogP | 6.36 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|