About (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate
(2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate (PubChem CID 174602970) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate.
Molecular Properties
| Compound Name | (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate |
| PubChem CID | 174602970 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate |
| SMILES | [H]/N=C(\N)c1ccccc1OC(=O)CCc1ccccc1N |
| InChI | InChI=1S/C16H17N3O2/c17-13-7-3-1-5-11(13)9-10-15(20)21-14-8-4-2-6-12(14)16(18)19/h1-8H,9-10,17H2,(H3,18,19) |
| InChIKey | XEVOSPSOJFXLON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate?
The IUPAC name of (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate (CID 174602970) is (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate.
What is the SMILES notation for (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate?
The canonical SMILES for (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate is [H]/N=C(\N)c1ccccc1OC(=O)CCc1ccccc1N.
What is the InChIKey of (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate?
The InChIKey is XEVOSPSOJFXLON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c17-13-7-3-1-5-11(13)9-10-15(20)21-14-8-4-2-6-12(14)16(18)19/h1-8H,9-10,17H2,(H3,18,19).
What are the key properties of (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate?
(2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate has a molecular weight of 283.33 g/mol, XLogP of 2.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamimidoylphenyl) 3-(2-aminophenyl)propanoate is sourced from PubChem (CID 174602970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).