C9H10ClN5O2S — CID 83083463
(5-chloro-2-nitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083463) has the molecular formula C9H10ClN5O2S and a molecular weight of 287.73 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (5-chloro-2-nitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083463 |
| Molecular Formula | C9H10ClN5O2S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (5-chloro-2-nitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN5O2S/c10-6-1-2-7(15(16)17)5(3-6)4-18-9(13)14-8(11)12/h1-3H,4H2,(H5,11,12,13,14) |
| InChIKey | RXLGIRHABLHUDH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|