About (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide
(3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide (PubChem CID 118705720) has the molecular formula C15H16BrN3O5S2
and a molecular weight of 462.35 g/mol. Its IUPAC name is (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide.
Molecular Properties
| Compound Name | (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide |
| PubChem CID | 118705720 |
| Molecular Formula | C15H16BrN3O5S2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 460.97 |
| IUPAC Name | (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1ccc(CS(=O)(=O)Oc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H15N3O5S2.BrH/c16-15(17)24-9-11-4-6-12(7-5-11)10-25(21,22)23-14-3-1-2-13(8-14)18(19)20;/h1-8H,9-10H2,(H3,16,17);1H |
| InChIKey | HROCCLXUYWUYIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide?
The IUPAC name of (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide (CID 118705720) is (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide.
What is the SMILES notation for (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide?
The canonical SMILES for (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide is Br.[H]/N=C(\N)SCc1ccc(CS(=O)(=O)Oc2cccc([N+](=O)[O-])c2)cc1.
What is the InChIKey of (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide?
The InChIKey is HROCCLXUYWUYIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O5S2.BrH/c16-15(17)24-9-11-4-6-12(7-5-11)10-25(21,22)23-14-3-1-2-13(8-14)18(19)20;/h1-8H,9-10H2,(H3,16,17);1H.
What are the key properties of (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide?
(3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide has a molecular weight of 462.35 g/mol, XLogP of 3.21, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) [4-(carbamimidoylsulfanylmethyl)phenyl]methanesulfonate;hydrobromide is sourced from PubChem (CID 118705720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).