C18H19FN4O6S — CID 70367394
dimethyl 2-(carbamimidoylsulfanylmethyl)-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70367394) has the molecular formula C18H19FN4O6S and a molecular weight of 438.44 g/mol. Its IUPAC name is dimethyl 2-(carbamimidoylsulfanylmethyl)-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2-(carbamimidoylsulfanylmethyl)-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70367394 |
| Molecular Formula | C18H19FN4O6S |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | dimethyl 2-(carbamimidoylsulfanylmethyl)-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C(\N)SCC1=C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC)=C(CF)N1 |
| InChI | InChI=1S/C18H19FN4O6S/c1-28-16(24)14-11(7-19)22-12(8-30-18(20)21)15(17(25)29-2)13(14)9-4-3-5-10(6-9)23(26)27/h3-6,13,22H,7-8H2,1-2H3,(H3,20,21) |
| InChIKey | QEWHYUCCUVOXDI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|