C24H22F2N2O6S — CID 19796544
3-O-ethyl 5-O-methyl 2-[(2,4-difluorophenyl)sulfanylmethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19796544) has the molecular formula C24H22F2N2O6S and a molecular weight of 504.51 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-[(2,4-difluorophenyl)sulfanylmethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-[(2,4-difluorophenyl)sulfanylmethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19796544 |
| Molecular Formula | C24H22F2N2O6S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-[(2,4-difluorophenyl)sulfanylmethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CSc2ccc(F)cc2F)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22F2N2O6S/c1-4-34-24(30)22-18(12-35-19-9-8-15(25)11-17(19)26)27-13(2)20(23(29)33-3)21(22)14-6-5-7-16(10-14)28(31)32/h5-11,21,27H,4,12H2,1-3H3 |
| InChIKey | YGEVRIHBXHLULE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|