C12H12N4O3S — CID 83082663
(7-hydroxy-2-oxochromen-4-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082663) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082663 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C12H12N4O3S/c13-11(14)16-12(15)20-5-6-3-10(18)19-9-4-7(17)1-2-8(6)9/h1-4,17H,5H2,(H5,13,14,15,16) |
| InChIKey | MLFBGAFFBZDXHX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|