C16H10Br4N4O4 — CID 51064340
[(E)-[(2E)-2-[(2,4-dibromophenyl)carbamoyloxyimino]ethylidene]amino] N-(2,4-dibromophenyl)carbamate (PubChem CID 51064340) has the molecular formula C16H10Br4N4O4 and a molecular weight of 641.90 g/mol. Its IUPAC name is [(E)-[(2E)-2-[(2,4-dibromophenyl)carbamoyloxyimino]ethylidene]amino] N-(2,4-dibromophenyl)carbamate.
| Compound Name | [(E)-[(2E)-2-[(2,4-dibromophenyl)carbamoyloxyimino]ethylidene]amino] N-(2,4-dibromophenyl)carbamate |
|---|---|
| PubChem CID | 51064340 |
| Molecular Formula | C16H10Br4N4O4 |
| Molecular Weight | 641.90 g/mol |
| Exact Mass | 637.74 |
| IUPAC Name | [(E)-[(2E)-2-[(2,4-dibromophenyl)carbamoyloxyimino]ethylidene]amino] N-(2,4-dibromophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Br)cc1Br)O/N=C/C=N/OC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H10Br4N4O4/c17-9-1-3-13(11(19)7-9)23-15(25)27-21-5-6-22-28-16(26)24-14-4-2-10(18)8-12(14)20/h1-8H,(H,23,25)(H,24,26)/b21-5+,22-6+ |
| InChIKey | YRQDQFZGBRMIEO-OXAZHYLESA-N |
| XLogP | 6.51 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.90 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|