C18H16N6O8 — CID 51064197
[(E)-[(2Z)-2-[(4-methyl-2-nitrophenyl)carbamoyloxyimino]ethylidene]amino] N-(4-methyl-2-nitrophenyl)carbamate (PubChem CID 51064197) has the molecular formula C18H16N6O8 and a molecular weight of 444.36 g/mol. Its IUPAC name is [(E)-[(2Z)-2-[(4-methyl-2-nitrophenyl)carbamoyloxyimino]ethylidene]amino] N-(4-methyl-2-nitrophenyl)carbamate.
| Compound Name | [(E)-[(2Z)-2-[(4-methyl-2-nitrophenyl)carbamoyloxyimino]ethylidene]amino] N-(4-methyl-2-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 51064197 |
| Molecular Formula | C18H16N6O8 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [(E)-[(2Z)-2-[(4-methyl-2-nitrophenyl)carbamoyloxyimino]ethylidene]amino] N-(4-methyl-2-nitrophenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O/N=C\C=N\OC(=O)Nc2ccc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O8/c1-11-3-5-13(15(9-11)23(27)28)21-17(25)31-19-7-8-20-32-18(26)22-14-6-4-12(2)10-16(14)24(29)30/h3-10H,1-2H3,(H,21,25)(H,22,26)/b19-7-,20-8+ |
| InChIKey | GDYMXTWTCNHRGR-NORIJPHCSA-N |
| XLogP | 3.89 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|