C11H8Br2N2O4 — CID 109374331
(E)-4-[(2,4-dibromophenyl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 109374331) has the molecular formula C11H8Br2N2O4 and a molecular weight of 392.00 g/mol. Its IUPAC name is (E)-4-[(2,4-dibromophenyl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2,4-dibromophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 109374331 |
| Molecular Formula | C11H8Br2N2O4 |
| Molecular Weight | 392.00 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | (E)-4-[(2,4-dibromophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H8Br2N2O4/c12-6-1-2-8(7(13)5-6)14-11(19)15-9(16)3-4-10(17)18/h1-5H,(H,17,18)(H2,14,15,16,19)/b4-3+ |
| InChIKey | GXLOKTWZSNAGHS-ONEGZZNKSA-N |
| XLogP | 2.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|