C11H8BrFN2O4 — CID 77069396
4-[(4-bromo-3-fluorophenyl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 77069396) has the molecular formula C11H8BrFN2O4 and a molecular weight of 331.10 g/mol. Its IUPAC name is 4-[(4-bromo-3-fluorophenyl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(4-bromo-3-fluorophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77069396 |
| Molecular Formula | C11H8BrFN2O4 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-[(4-bromo-3-fluorophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H8BrFN2O4/c12-7-2-1-6(5-8(7)13)14-11(19)15-9(16)3-4-10(17)18/h1-5H,(H,17,18)(H2,14,15,16,19) |
| InChIKey | AKEBJVIPYFTCJO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|