C11H9IN2O4 — CID 28976740
(E)-4-[(4-iodophenyl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 28976740) has the molecular formula C11H9IN2O4 and a molecular weight of 360.11 g/mol. Its IUPAC name is (E)-4-[(4-iodophenyl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(4-iodophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 28976740 |
| Molecular Formula | C11H9IN2O4 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | (E)-4-[(4-iodophenyl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H9IN2O4/c12-7-1-3-8(4-2-7)13-11(18)14-9(15)5-6-10(16)17/h1-6H,(H,16,17)(H2,13,14,15,18)/b6-5+ |
| InChIKey | YOWRMBRWRGZQIX-AATRIKPKSA-N |
| XLogP | 1.58 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|