C11H14BrN5OS — CID 83083373
[2-(4-bromo-3-methylanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083373) has the molecular formula C11H14BrN5OS and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083373 |
| Molecular Formula | C11H14BrN5OS |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C11H14BrN5OS/c1-6-4-7(2-3-8(6)12)16-9(18)5-19-11(15)17-10(13)14/h2-4H,5H2,1H3,(H,16,18)(H5,13,14,15,17) |
| InChIKey | IHTOPCQNZWUFMY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|