C14H19BrN2O3S — CID 106443492
(2S)-2-amino-3-[2-(4-bromo-3-methylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106443492) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(4-bromo-3-methylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(4-bromo-3-methylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443492 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (2S)-2-amino-3-[2-(4-bromo-3-methylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | Cc1cc(NC(=O)CSC(C)(C)[C@@H](N)C(=O)O)ccc1Br |
| InChI | InChI=1S/C14H19BrN2O3S/c1-8-6-9(4-5-10(8)15)17-11(18)7-21-14(2,3)12(16)13(19)20/h4-6,12H,7,16H2,1-3H3,(H,17,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | VUVWHQOVUZICLE-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |