C13H17Br2N3OS — CID 4968515
[2-(2,4-dibromoanilino)-2-oxoethyl] N,N'-diethylcarbamimidothioate (PubChem CID 4968515) has the molecular formula C13H17Br2N3OS and a molecular weight of 423.17 g/mol. Its IUPAC name is [2-(2,4-dibromoanilino)-2-oxoethyl] N,N'-diethylcarbamimidothioate.
| Compound Name | [2-(2,4-dibromoanilino)-2-oxoethyl] N,N'-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 4968515 |
| Molecular Formula | C13H17Br2N3OS |
| Molecular Weight | 423.17 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | [2-(2,4-dibromoanilino)-2-oxoethyl] N,N'-diethylcarbamimidothioate |
| SMILES | CC/N=C(\NCC)SCC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2N3OS/c1-3-16-13(17-4-2)20-8-12(19)18-11-6-5-9(14)7-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | KZDUDSHIDPOVOH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|