C15H16Br2N2O6 — CID 24686669
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate (PubChem CID 24686669) has the molecular formula C15H16Br2N2O6 and a molecular weight of 480.11 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24686669 |
| Molecular Formula | C15H16Br2N2O6 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(O)CCCCC1)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C15H16Br2N2O6/c16-10-6-9(19(23)24)7-11(17)13(10)18-12(20)8-25-14(21)15(22)4-2-1-3-5-15/h6-7,22H,1-5,8H2,(H,18,20) |
| InChIKey | PAUBYSUYZOZHIA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|