C19H19Br3N2O5 — CID 5145434
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate (PubChem CID 5145434) has the molecular formula C19H19Br3N2O5 and a molecular weight of 595.08 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 5145434 |
| Molecular Formula | C19H19Br3N2O5 |
| Molecular Weight | 595.08 g/mol |
| Exact Mass | 591.88 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(Br)(C3)C1)C2)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C19H19Br3N2O5/c20-13-2-12(24(27)28)3-14(21)16(13)23-15(25)8-29-17(26)18-4-10-1-11(5-18)7-19(22,6-10)9-18/h2-3,10-11H,1,4-9H2,(H,23,25) |
| InChIKey | DIGNQFRXJBCNTQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|