C11H6Br2F2N4O3 — CID 19506748
N-(2,6-dibromo-4-nitrophenyl)-2-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 19506748) has the molecular formula C11H6Br2F2N4O3 and a molecular weight of 440.00 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-2-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-2-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506748 |
| Molecular Formula | C11H6Br2F2N4O3 |
| Molecular Weight | 440.00 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-2-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc([N+](=O)[O-])cc1Br)c1ccnn1C(F)F |
| InChI | InChI=1S/C11H6Br2F2N4O3/c12-6-3-5(19(21)22)4-7(13)9(6)17-10(20)8-1-2-16-18(8)11(14)15/h1-4,11H,(H,17,20) |
| InChIKey | HWWDYMVNXXOKDJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|