C20H13Br2N5O3 — CID 19440379
N-(2,6-dibromo-4-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19440379) has the molecular formula C20H13Br2N5O3 and a molecular weight of 531.16 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19440379 |
| Molecular Formula | C20H13Br2N5O3 |
| Molecular Weight | 531.16 g/mol |
| Exact Mass | 528.94 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccnc3c(C(=O)Nc4c(Br)cc([N+](=O)[O-])cc4Br)cnn23)cc1 |
| InChI | InChI=1S/C20H13Br2N5O3/c1-11-2-4-12(5-3-11)17-6-7-23-19-14(10-24-26(17)19)20(28)25-18-15(21)8-13(27(29)30)9-16(18)22/h2-10H,1H3,(H,25,28) |
| InChIKey | YRFUDRXDBNMTNC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.16 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|