C20H15N5O4 — CID 19440566
N-(2-hydroxy-5-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19440566) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19440566 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccnc3c(C(=O)Nc4cc([N+](=O)[O-])ccc4O)cnn23)cc1 |
| InChI | InChI=1S/C20H15N5O4/c1-12-2-4-13(5-3-12)17-8-9-21-19-15(11-22-24(17)19)20(27)23-16-10-14(25(28)29)6-7-18(16)26/h2-11,26H,1H3,(H,23,27) |
| InChIKey | KTRIDRMTRXIMPQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|