C16H16N4OS — CID 19440444
7-(4-methylphenyl)-N-(2-sulfanylethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19440444) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 7-(4-methylphenyl)-N-(2-sulfanylethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-(4-methylphenyl)-N-(2-sulfanylethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19440444 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 7-(4-methylphenyl)-N-(2-sulfanylethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccnc3c(C(=O)NCCS)cnn23)cc1 |
| InChI | InChI=1S/C16H16N4OS/c1-11-2-4-12(5-3-11)14-6-7-17-15-13(10-19-20(14)15)16(21)18-8-9-22/h2-7,10,22H,8-9H2,1H3,(H,18,21) |
| InChIKey | OKCMSGAVKXTRJL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|