C24H25N5O — CID 19440362
N-[4-(diethylamino)phenyl]-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19440362) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19440362 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-7-(4-methylphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cnn3c(-c4ccc(C)cc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-4-28(5-2)20-12-10-19(11-13-20)27-24(30)21-16-26-29-22(14-15-25-23(21)29)18-8-6-17(3)7-9-18/h6-16H,4-5H2,1-3H3,(H,27,30) |
| InChIKey | ASCRHJDUILSUFA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|