C17H9Br2N5O3S — CID 19416648
N-(2,6-dibromo-4-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416648) has the molecular formula C17H9Br2N5O3S and a molecular weight of 523.17 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416648 |
| Molecular Formula | C17H9Br2N5O3S |
| Molecular Weight | 523.17 g/mol |
| Exact Mass | 520.88 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc([N+](=O)[O-])cc1Br)c1cnn2c(-c3cccs3)ccnc12 |
| InChI | InChI=1S/C17H9Br2N5O3S/c18-11-6-9(24(26)27)7-12(19)15(11)22-17(25)10-8-21-23-13(3-4-20-16(10)23)14-2-1-5-28-14/h1-8H,(H,22,25) |
| InChIKey | IZNHBMPZJXWHAW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|