C20H17N5O5S — CID 19416783
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416783) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416783 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1cnn2c(-c3cccs3)ccnc12 |
| InChI | InChI=1S/C20H17N5O5S/c26-11-15(18(27)12-3-5-13(6-4-12)25(29)30)23-20(28)14-10-22-24-16(7-8-21-19(14)24)17-2-1-9-31-17/h1-10,15,18,26-27H,11H2,(H,23,28) |
| InChIKey | VKAYNOZSUDEARC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|