C22H23N7O5 — CID 19416540
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416540) has the molecular formula C22H23N7O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416540 |
| Molecular Formula | C22H23N7O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCn1cc(-c2ccnc3c(C(=O)NC(CO)C(O)c4ccc([N+](=O)[O-])cc4)cnn23)c(C)n1 |
| InChI | InChI=1S/C22H23N7O5/c1-3-27-11-17(13(2)26-27)19-8-9-23-21-16(10-24-28(19)21)22(32)25-18(12-30)20(31)14-4-6-15(7-5-14)29(33)34/h4-11,18,20,30-31H,3,12H2,1-2H3,(H,25,32) |
| InChIKey | YVZBVLVPPWWPIQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|