C17H11N5O3S — CID 19416752
N-(2-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416752) has the molecular formula C17H11N5O3S and a molecular weight of 365.37 g/mol. Its IUPAC name is N-(2-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416752 |
| Molecular Formula | C17H11N5O3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(2-nitrophenyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1cnn2c(-c3cccs3)ccnc12 |
| InChI | InChI=1S/C17H11N5O3S/c23-17(20-12-4-1-2-5-13(12)22(24)25)11-10-19-21-14(7-8-18-16(11)21)15-6-3-9-26-15/h1-10H,(H,20,23) |
| InChIKey | XQDPJSFUQMGHQC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|