C13H9N5O3 — CID 19414583
N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19414583) has the molecular formula C13H9N5O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19414583 |
| Molecular Formula | C13H9N5O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1cnn2cccnc12 |
| InChI | InChI=1S/C13H9N5O3/c19-13(9-8-15-17-7-3-6-14-12(9)17)16-10-4-1-2-5-11(10)18(20)21/h1-8H,(H,16,19) |
| InChIKey | RJCFUJRMMCAIGE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|