C13H6F4N4O — CID 19414444
N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19414444) has the molecular formula C13H6F4N4O and a molecular weight of 310.21 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19414444 |
| Molecular Formula | C13H6F4N4O |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1cnn2cccnc12 |
| InChI | InChI=1S/C13H6F4N4O/c14-7-4-8(15)10(17)11(9(7)16)20-13(22)6-5-19-21-3-1-2-18-12(6)21/h1-5H,(H,20,22) |
| InChIKey | XRXKWKTZDDLSKV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|