C26H27N5O6S — CID 4536390
5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]furan-2-carboxamide (PubChem CID 4536390) has the molecular formula C26H27N5O6S and a molecular weight of 537.60 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4536390 |
| Molecular Formula | C26H27N5O6S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cn4nc(C)c([N+](=O)[O-])c4C)o3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H27N5O6S/c1-15-12-16(2)24(17(3)13-15)29-38(35,36)22-9-6-20(7-10-22)27-26(32)23-11-8-21(37-23)14-30-19(5)25(31(33)34)18(4)28-30/h6-13,29H,14H2,1-5H3,(H,27,32) |
| InChIKey | QQIFUCWBDRPSKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|