C19H27BrN4O2 — CID 19416094
N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide (PubChem CID 19416094) has the molecular formula C19H27BrN4O2 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19416094 |
| Molecular Formula | C19H27BrN4O2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(CN3CCCCC3)o2)c(C)c1Br |
| InChI | InChI=1S/C19H27BrN4O2/c1-14-18(20)15(2)24(22-14)12-6-9-21-19(25)17-8-7-16(26-17)13-23-10-4-3-5-11-23/h7-8H,3-6,9-13H2,1-2H3,(H,21,25) |
| InChIKey | MEHLWPKQJJSHIT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|