C19H25NO5S — CID 3241769
N-(3-ethoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide (PubChem CID 3241769) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3241769 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(3-ethoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc(CS(=O)(=O)Cc2cccc(C)c2)o1 |
| InChI | InChI=1S/C19H25NO5S/c1-3-24-11-5-10-20-19(21)18-9-8-17(25-18)14-26(22,23)13-16-7-4-6-15(2)12-16/h4,6-9,12H,3,5,10-11,13-14H2,1-2H3,(H,20,21) |
| InChIKey | MFENPWNBLWTGAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|