C21H31N2O4S+ — CID 4107788
diethyl-[3-[[5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carbonyl]amino]propyl]azanium (PubChem CID 4107788) has the molecular formula C21H31N2O4S+ and a molecular weight of 407.56 g/mol. Its IUPAC name is diethyl-[3-[[5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carbonyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 4107788 |
| Molecular Formula | C21H31N2O4S+ |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | diethyl-[3-[[5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carbonyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)c1ccc(CS(=O)(=O)Cc2cccc(C)c2)o1 |
| InChI | InChI=1S/C21H30N2O4S/c1-4-23(5-2)13-7-12-22-21(24)20-11-10-19(27-20)16-28(25,26)15-18-9-6-8-17(3)14-18/h6,8-11,14H,4-5,7,12-13,15-16H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | MUSXTEWCSZGPRB-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|