C23H31ClN2O4S — CID 20968743
5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-[cyclohexyl(methyl)amino]propyl]furan-2-carboxamide (PubChem CID 20968743) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-[cyclohexyl(methyl)amino]propyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-[cyclohexyl(methyl)amino]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20968743 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-[cyclohexyl(methyl)amino]propyl]furan-2-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc(CS(=O)(=O)Cc2cccc(Cl)c2)o1)C1CCCCC1 |
| InChI | InChI=1S/C23H31ClN2O4S/c1-26(20-9-3-2-4-10-20)14-6-13-25-23(27)22-12-11-21(30-22)17-31(28,29)16-18-7-5-8-19(24)15-18/h5,7-8,11-12,15,20H,2-4,6,9-10,13-14,16-17H2,1H3,(H,25,27) |
| InChIKey | GNZFZPDNUVTKEJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|