C22H29ClN2O4S — CID 20968740
5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-(3-methylpiperidin-1-yl)propyl]furan-2-carboxamide (PubChem CID 20968740) has the molecular formula C22H29ClN2O4S and a molecular weight of 453.00 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-(3-methylpiperidin-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-(3-methylpiperidin-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20968740 |
| Molecular Formula | C22H29ClN2O4S |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 5-[(3-chlorophenyl)methylsulfonylmethyl]-N-[3-(3-methylpiperidin-1-yl)propyl]furan-2-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2ccc(CS(=O)(=O)Cc3cccc(Cl)c3)o2)C1 |
| InChI | InChI=1S/C22H29ClN2O4S/c1-17-5-3-11-25(14-17)12-4-10-24-22(26)21-9-8-20(29-21)16-30(27,28)15-18-6-2-7-19(23)13-18/h2,6-9,13,17H,3-5,10-12,14-16H2,1H3,(H,24,26) |
| InChIKey | AJYRDMDTSWPFQE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|