C23H33N2O4S+ — CID 4107780
5-[(3-methylphenyl)methylsulfonylmethyl]-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]furan-2-carboxamide (PubChem CID 4107780) has the molecular formula C23H33N2O4S+ and a molecular weight of 433.59 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methylsulfonylmethyl]-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-[(3-methylphenyl)methylsulfonylmethyl]-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4107780 |
| Molecular Formula | C23H33N2O4S+ |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-[(3-methylphenyl)methylsulfonylmethyl]-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]furan-2-carboxamide |
| SMILES | Cc1cccc(CS(=O)(=O)Cc2ccc(C(=O)NCCC[NH+]3CCC(C)CC3)o2)c1 |
| InChI | InChI=1S/C23H32N2O4S/c1-18-9-13-25(14-10-18)12-4-11-24-23(26)22-8-7-21(29-22)17-30(27,28)16-20-6-3-5-19(2)15-20/h3,5-8,15,18H,4,9-14,16-17H2,1-2H3,(H,24,26)/p+1 |
| InChIKey | CRPYDWPGPXPHJN-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|