C21H19ClFNO4S — CID 5049846
N-[2-(4-chlorophenyl)ethyl]-5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide (PubChem CID 5049846) has the molecular formula C21H19ClFNO4S and a molecular weight of 435.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5049846 |
| Molecular Formula | C21H19ClFNO4S |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(CS(=O)(=O)Cc2ccccc2F)o1 |
| InChI | InChI=1S/C21H19ClFNO4S/c22-17-7-5-15(6-8-17)11-12-24-21(25)20-10-9-18(28-20)14-29(26,27)13-16-3-1-2-4-19(16)23/h1-10H,11-14H2,(H,24,25) |
| InChIKey | HTHXXHUQACJWRF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |