C13H11ClO5S — CID 4516597
5-[(2-chlorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid (PubChem CID 4516597) has the molecular formula C13H11ClO5S and a molecular weight of 314.75 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-chlorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 4516597 |
| Molecular Formula | C13H11ClO5S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CS(=O)(=O)Cc2ccccc2Cl)o1 |
| InChI | InChI=1S/C13H11ClO5S/c14-11-4-2-1-3-9(11)7-20(17,18)8-10-5-6-12(19-10)13(15)16/h1-6H,7-8H2,(H,15,16) |
| InChIKey | QMXJMLPXSYQTQQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |