C12H9ClO4S — CID 92730218
5-[[(S)-(2-chlorophenyl)sulfinyl]methyl]furan-2-carboxylic acid (PubChem CID 92730218) has the molecular formula C12H9ClO4S and a molecular weight of 284.72 g/mol. Its IUPAC name is 5-[[(S)-(2-chlorophenyl)sulfinyl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(S)-(2-chlorophenyl)sulfinyl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 92730218 |
| Molecular Formula | C12H9ClO4S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 5-[[(S)-(2-chlorophenyl)sulfinyl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C[S@](=O)c2ccccc2Cl)o1 |
| InChI | InChI=1S/C12H9ClO4S/c13-9-3-1-2-4-11(9)18(16)7-8-5-6-10(17-8)12(14)15/h1-6H,7H2,(H,14,15)/t18-/m0/s1 |
| InChIKey | OTIFSWMXZXWQFC-SFHVURJKSA-N |
| XLogP | 2.94 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |