C20H22ClNO3S — CID 22554607
5-[(2-chlorophenyl)sulfinylmethyl]-N-[2-(cyclohexen-1-yl)ethyl]furan-2-carboxamide (PubChem CID 22554607) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)sulfinylmethyl]-N-[2-(cyclohexen-1-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chlorophenyl)sulfinylmethyl]-N-[2-(cyclohexen-1-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22554607 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-[(2-chlorophenyl)sulfinylmethyl]-N-[2-(cyclohexen-1-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(CS(=O)c2ccccc2Cl)o1 |
| InChI | InChI=1S/C20H22ClNO3S/c21-17-8-4-5-9-19(17)26(24)14-16-10-11-18(25-16)20(23)22-13-12-15-6-2-1-3-7-15/h4-6,8-11H,1-3,7,12-14H2,(H,22,23) |
| InChIKey | VTFYMEZSJYWHNM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|