C20H18ClNO3S — CID 20859472
5-(benzenesulfinylmethyl)-N-[2-(4-chlorophenyl)ethyl]furan-2-carboxamide (PubChem CID 20859472) has the molecular formula C20H18ClNO3S and a molecular weight of 387.89 g/mol. Its IUPAC name is 5-(benzenesulfinylmethyl)-N-[2-(4-chlorophenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfinylmethyl)-N-[2-(4-chlorophenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20859472 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 5-(benzenesulfinylmethyl)-N-[2-(4-chlorophenyl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(CS(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C20H18ClNO3S/c21-16-8-6-15(7-9-16)12-13-22-20(23)19-11-10-17(25-19)14-26(24)18-4-2-1-3-5-18/h1-11H,12-14H2,(H,22,23) |
| InChIKey | MCUZAWDSRIHSNG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |