C19H15ClFNO3S — CID 22554499
5-[(3-chlorophenyl)sulfinylmethyl]-N-[(4-fluorophenyl)methyl]furan-2-carboxamide (PubChem CID 22554499) has the molecular formula C19H15ClFNO3S and a molecular weight of 391.85 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)sulfinylmethyl]-N-[(4-fluorophenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)sulfinylmethyl]-N-[(4-fluorophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22554499 |
| Molecular Formula | C19H15ClFNO3S |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 5-[(3-chlorophenyl)sulfinylmethyl]-N-[(4-fluorophenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(CS(=O)c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C19H15ClFNO3S/c20-14-2-1-3-17(10-14)26(24)12-16-8-9-18(25-16)19(23)22-11-13-4-6-15(21)7-5-13/h1-10H,11-12H2,(H,22,23) |
| InChIKey | RSUFNIUIRTYNRA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |