C22H22ClNO4S — CID 20899478
5-[(3-chlorophenyl)methylsulfinylmethyl]-N-[(4-ethoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 20899478) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylsulfinylmethyl]-N-[(4-ethoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methylsulfinylmethyl]-N-[(4-ethoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20899478 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-[(3-chlorophenyl)methylsulfinylmethyl]-N-[(4-ethoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc(CS(=O)Cc3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C22H22ClNO4S/c1-2-27-19-8-6-16(7-9-19)13-24-22(25)21-11-10-20(28-21)15-29(26)14-17-4-3-5-18(23)12-17/h3-12H,2,13-15H2,1H3,(H,24,25) |
| InChIKey | SDZRRSUDNGIUNP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |